Information card for entry 2207096
| Common name |
N-(nitroso)-8,9-benzo-1-aza-4,7,10,13-tetraoxacyclopentadeca-8-ene |
| Chemical name |
11-Nitroso-6,7,10,11,12,13,15,16-octahydro-9H-5,8,14,17- tetraoxa-11-azabenzocyclopentadecene |
| Formula |
C14 H20 N2 O5 |
| Calculated formula |
C14 H20 N2 O5 |
| SMILES |
N(=O)N1CCOCCOc2c(OCCOCC1)cccc2 |
| Title of publication |
11-Nitroso-6,7,10,11,12,13,15,16-octahydro-9<i>H</i>-5,8,14,17-tetraoxa-11-azabenzocyclopentadecene |
| Authors of publication |
Simonov, Yurii A.; Gonta, Maria V.; Yavolovskii, Arkadii A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
10 |
| Pages of publication |
o3136 - o3139 |
| a |
8.3002 ± 0.0006 Å |
| b |
20.6868 ± 0.0014 Å |
| c |
8.5584 ± 0.0006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1469.52 ± 0.18 Å3 |
| Cell temperature |
130 ± 2 K |
| Ambient diffraction temperature |
130 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0304 |
| Residual factor for significantly intense reflections |
0.029 |
| Weighted residual factors for significantly intense reflections |
0.0703 |
| Weighted residual factors for all reflections included in the refinement |
0.0712 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207096.html