Information card for entry 2207164
| Chemical name |
17-isopropyl-3-methoxy-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro- 6H-cyclopenta[a]phenanthrene |
| Formula |
C22 H32 O |
| Calculated formula |
C22 H32 O |
| SMILES |
O(c1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(C)C)C)C.O(c1ccc2c(c1)CC[C@H]1[C@H]2CC[C@@]2([C@@H]1CC[C@H]2C(C)C)C)C |
| Title of publication |
17-Isopropyl-3-methoxy-13-methyl-7,8,9,11,12,13,14,15,16,17-decahydro-6<i>H</i>-cyclopenta[<i>a</i>]phenanthrene |
| Authors of publication |
Kooijman, Huub; Sarabèr, Florence C. E.; Groot, Aede de; Spek, Anthony L. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2005 |
| Journal volume |
61 |
| Journal issue |
11 |
| Pages of publication |
o3908 - o3909 |
| a |
21.26 ± 0.006 Å |
| b |
6.1189 ± 0.001 Å |
| c |
13.662 ± 0.003 Å |
| α |
90° |
| β |
90.35 ± 0.01° |
| γ |
90° |
| Cell volume |
1777.2 ± 0.7 Å3 |
| Cell temperature |
150 K |
| Ambient diffraction temperature |
150 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0878 |
| Residual factor for significantly intense reflections |
0.0486 |
| Weighted residual factors for significantly intense reflections |
0.1121 |
| Weighted residual factors for all reflections included in the refinement |
0.1313 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.025 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207164.html