Information card for entry 2207736
| Chemical name |
Isopropyl 2,5-anhydro-6-azido-3,6-dideoxy-D-xylo-hexonate |
| Formula |
C9 H15 N3 O4 |
| Calculated formula |
C9 H15 N3 O4 |
| SMILES |
O(C(=O)[C@@H]1O[C@H](CN=N#N)[C@@H](C1)O)C(C)C |
| Title of publication |
Isopropyl 2,5-anhydro-6-azido-3,6-dideoxy-<small>D</small>-<i>xylo</i>-hexonate |
| Authors of publication |
Watkin, David J.; Watterson, Mark; Tranter, George E.; Edwards, Alison A.; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
1 |
| Pages of publication |
o363 - o365 |
| a |
5.4778 ± 0.0007 Å |
| b |
11.0701 ± 0.0013 Å |
| c |
18.2529 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1106.9 ± 0.2 Å3 |
| Cell temperature |
190 K |
| Ambient diffraction temperature |
190 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0397 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for all reflections |
0.1042 |
| Weighted residual factors for significantly intense reflections |
0.1042 |
| Weighted residual factors for all reflections included in the refinement |
0.1042 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.9438 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207736.html