Information card for entry 2207820
| Chemical name |
2-C-Azidomethyl-2-deoxy-3,4-O-isopropylidene-D-ribono-1,5-lactone |
| Formula |
C9 H13 N3 O4 |
| Calculated formula |
C9 H13 N3 O4 |
| SMILES |
[C@H]12[C@H](C(=O)OC[C@H]1OC(O2)(C)C)CN=N#N |
| Title of publication |
2-<i>C</i>-Azidomethyl-2-deoxy-3,4-<i>O</i>-isopropylidene-<small>D</small>-ribono-1,5-lactone |
| Authors of publication |
Punzo, Francesco; Watkin, David J.; Jenkinson, Sarah F.; da Cruz, Filipa P.; Fleet, George W. J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
1 |
| Pages of publication |
o321 - o323 |
| a |
6.6145 ± 0.0002 Å |
| b |
11.1194 ± 0.0004 Å |
| c |
15.0252 ± 0.0008 Å |
| α |
90° |
| β |
91.6306 ± 0.0013° |
| γ |
90° |
| Cell volume |
1104.65 ± 0.08 Å3 |
| Cell temperature |
250 K |
| Ambient diffraction temperature |
250 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0941 |
| Residual factor for significantly intense reflections |
0.0469 |
| Weighted residual factors for all reflections |
0.1288 |
| Weighted residual factors for significantly intense reflections |
0.0871 |
| Weighted residual factors for all reflections included in the refinement |
0.1288 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.0765 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207820.html
