Information card for entry 2207845
| Chemical name |
3,6-Di-3-pyridylpyrrolo[3,4-c]pyrrole-1,4(2H,5H)-dione |
| Formula |
C16 H10 N4 O2 |
| Calculated formula |
C16 H10 N4 O2 |
| SMILES |
C12C(=O)NC(c3cccnc3)=C1C(=O)NC=2c1cccnc1 |
| Title of publication |
3,6-Di-3-pyridylpyrrolo[3,4-<i>c</i>]pyrrole-1,4(2<i>H</i>,5<i>H</i>)-dione |
| Authors of publication |
Hirota, Tsuyoshi; Imoda, Tomohiko; Takahashi, Hiroo; Mizuguchi, Jin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
1 |
| Pages of publication |
o111 - o113 |
| a |
3.6616 ± 0.0005 Å |
| b |
15.0089 ± 0.0019 Å |
| c |
10.9791 ± 0.0013 Å |
| α |
90° |
| β |
98.823 ± 0.009° |
| γ |
90° |
| Cell volume |
596.23 ± 0.13 Å3 |
| Cell temperature |
100.1 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.068 |
| Weighted residual factors for all reflections included in the refinement |
0.2134 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.026 |
| Diffraction radiation wavelength |
1.5419 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207845.html