Information card for entry 2207872
| Chemical name |
(2,2'-Diamino-4,4'-bi-1,3-thiazole-κ^2^N,N')bis(glycinato-κ^2^N,O)zinc(II) dihydrate |
| Formula |
C10 H18 N6 O6 S2 Zn |
| Calculated formula |
C10 H18 N6 O6 S2 Zn |
| SMILES |
c12csc([n]1[Zn]13([NH2]CC(=O)O1)([n]1c2csc1N)[NH2]CC(=O)O3)N.O.O |
| Title of publication |
(2,2'-Diamino-4,4'-bi-1,3-thiazole-κ^2^<i>N</i>,<i>N</i>')bis(glycinato-κ^2^<i>N</i>,<i>O</i>)zinc(II) dihydrate |
| Authors of publication |
Bing-Xin Liu; Jian-Yong Yu; Duan-Jun Xu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
1 |
| Pages of publication |
m67 - m68 |
| a |
13.121 ± 0.002 Å |
| b |
9.0063 ± 0.0016 Å |
| c |
14.124 ± 0.002 Å |
| α |
90° |
| β |
92.365 ± 0.006° |
| γ |
90° |
| Cell volume |
1667.6 ± 0.5 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.023 |
| Residual factor for significantly intense reflections |
0.021 |
| Weighted residual factors for significantly intense reflections |
0.053 |
| Weighted residual factors for all reflections included in the refinement |
0.054 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2207872.html