Information card for entry 2208108
| Chemical name |
1,3,5-Tris(4-chlorophenyl)-1,3,5-triazinane-2,4,6-trione acetone solvate |
| Formula |
C25 H21 Cl3 N3 O4 |
| Calculated formula |
C25 H21 Cl3 N3 O4 |
| SMILES |
CC(O)(C)C.Clc1ccc(cc1)N1C(=O)N(c2ccc(cc2)Cl)C(=O)N(C1=O)c1ccc(cc1)Cl |
| Title of publication |
1,3,5-Tris(4-chlorophenyl)-1,3,5-triazinane-2,4,6-trione acetone solvate |
| Authors of publication |
Yan-Ping Luo; Hong-Bin Zhou |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
2 |
| Pages of publication |
o538 - o539 |
| a |
12.7911 ± 0.0009 Å |
| b |
12.7911 ± 0.0009 Å |
| c |
26.403 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
3741.1 ± 0.7 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
161 |
| Hermann-Mauguin space group symbol |
R 3 c :H |
| Hall space group symbol |
R 3 -2"c |
| Residual factor for all reflections |
0.0608 |
| Residual factor for significantly intense reflections |
0.0491 |
| Weighted residual factors for significantly intense reflections |
0.1076 |
| Weighted residual factors for all reflections included in the refinement |
0.1124 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.949 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208108.html