Information card for entry 2208120
| Chemical name |
Dimethyl 7-(N,N-dimethylamino)-3-(2-methoxybenzoyl)indolizine-1,2-dicarbxylate |
| Formula |
C22 H22 N2 O6 |
| Calculated formula |
C22 H22 N2 O6 |
| SMILES |
O=C(OC)c1c(c(n2ccc(N(C)C)cc12)C(=O)c1c(OC)cccc1)C(=O)OC |
| Title of publication |
Dimethyl 7-(<i>N</i>,<i>N</i>-dimethylamino)-3-(2-methoxybenzoyl)indolizine-1,2-dicarboxylate |
| Authors of publication |
Hema, R.; Parthasarathi, V.; Ravikumar, K.; Sarkunam, K.; Nallu, M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
2 |
| Pages of publication |
o706 - o707 |
| a |
28.878 ± 0.003 Å |
| b |
8.0015 ± 0.0008 Å |
| c |
18.7634 ± 0.0018 Å |
| α |
90° |
| β |
109.547 ± 0.002° |
| γ |
90° |
| Cell volume |
4085.7 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0844 |
| Residual factor for significantly intense reflections |
0.0602 |
| Weighted residual factors for significantly intense reflections |
0.1345 |
| Weighted residual factors for all reflections included in the refinement |
0.1465 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.117 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208120.html