Information card for entry 2208342
| Common name |
12-Methoxy-15-(4-pyrrolidin-1-yl)podocarpa-8,11,13-trien-15-one |
| Chemical name |
3-Methoxy-4b,8-dimethyl-8-(4-pyrrolidin-1-ylcarbonyl)- 4b,5,6,7,8,8a,9,10-octahydrophenanthrene |
| Formula |
C22 H31 N O2 |
| Calculated formula |
C22 H31 N O2 |
| SMILES |
O=C(N1CCCC1)[C@]1(CCC[C@]2([C@H]1CCc1c2cc(OC)cc1)C)C |
| Title of publication |
12-Methoxy-15-(1-pyrrolidino)podocarpa-8,11,13-triene-15-one |
| Authors of publication |
Butcher, Ray J.; Bakare, Oladapo; John, Nicole J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
3 |
| Pages of publication |
o945 - o947 |
| a |
9.2758 ± 0.0018 Å |
| b |
14.886 ± 0.003 Å |
| c |
13.785 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1903.4 ± 0.7 Å3 |
| Cell temperature |
93 ± 2 K |
| Ambient diffraction temperature |
93 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0426 |
| Residual factor for significantly intense reflections |
0.0351 |
| Weighted residual factors for significantly intense reflections |
0.0878 |
| Weighted residual factors for all reflections included in the refinement |
0.0914 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.05 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208342.html