Information card for entry 2208559
| Chemical name |
4-(4-Methoxyphenyl)-5-(4-methylphenyl)-3-(2-pyridyl)-4H-1,2,4-triazole |
| Formula |
C21 H18 N4 O |
| Calculated formula |
C21 H18 N4 O |
| SMILES |
c1(c2ccc(cc2)C)nnc(c2ccccn2)n1c1ccc(cc1)OC |
| Title of publication |
4-(4-Methoxyphenyl)-5-(4-methylphenyl)-3-(2-pyridyl)-4<i>H</i>-1,2,4-triazole |
| Authors of publication |
Zhang, Shu-Ping; Liu, Zhao-Di; Chen, Shui-Dheng; Yang, Song; Shao, Si-Chang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
4 |
| Pages of publication |
o1516 - o1517 |
| a |
11.561 ± 0.004 Å |
| b |
19.044 ± 0.007 Å |
| c |
8.54 ± 0.003 Å |
| α |
90° |
| β |
110.104 ± 0.006° |
| γ |
90° |
| Cell volume |
1765.7 ± 1.1 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1467 |
| Residual factor for significantly intense reflections |
0.0456 |
| Weighted residual factors for significantly intense reflections |
0.0847 |
| Weighted residual factors for all reflections included in the refinement |
0.0961 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.919 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208559.html