Information card for entry 2208977
| Common name |
4-Hydroxy-5,6-dihydro-4H-1,3-thiazine |
| Chemical name |
(S)-4-Ethyl-4-hydroxy-2-phenyl-5,6-dihydro-4H-1,3-thiazine |
| Formula |
C12 H15 N O S |
| Calculated formula |
C12 H15 N O S |
| SMILES |
S1C(=NC(CC1)(O)CC)c1ccccc1 |
| Title of publication |
4-Ethyl-4-hydroxy-2-phenyl-5,6-dihydro-4<i>H</i>-1,3-thiazine |
| Authors of publication |
Koketsu, Mamoru; Ebihara, Masahiro; Ishihara, Hideharu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
5 |
| Pages of publication |
o1666 - o1668 |
| a |
9.4353 ± 0.0002 Å |
| b |
6.7725 ± 0.0002 Å |
| c |
18.3013 ± 0.0006 Å |
| α |
90° |
| β |
93.606 ± 0.0013° |
| γ |
90° |
| Cell volume |
1167.15 ± 0.06 Å3 |
| Cell temperature |
190 ± 2 K |
| Ambient diffraction temperature |
190 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.057 |
| Residual factor for significantly intense reflections |
0.0366 |
| Weighted residual factors for significantly intense reflections |
0.0829 |
| Weighted residual factors for all reflections included in the refinement |
0.0934 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.039 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2208977.html