Information card for entry 2209017
| Chemical name |
(3R,4R)-(-)-3-Hydroxymethyl-4-phenyl-2-o-toluoyl-1,2,3,4-tetrahydroisoquinoline |
| Formula |
C24 H23 N O2 |
| Calculated formula |
C24 H23 N O2 |
| SMILES |
C1N([C@H]([C@@H](c2ccccc12)c1ccccc1)CO)C(=O)c1c(cccc1)C |
| Title of publication |
(3<i>R</i>,4<i>R</i>)-(–)-3-Hydroxymethyl-4-phenyl-2-<i>o</i>-toluoyl-1,2,3,4-tetrahydroisoquinoline |
| Authors of publication |
Gzella, Andrzej; Chrzanowska, Maria; Dreas, Agnieszka; Kaczmarek, Michał S.; Woźniak, Zenon |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
5 |
| Pages of publication |
o1774 - o1776 |
| a |
9.0424 ± 0.001 Å |
| b |
10.4114 ± 0.0011 Å |
| c |
20.191 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1900.9 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.031 |
| Residual factor for significantly intense reflections |
0.029 |
| Weighted residual factors for significantly intense reflections |
0.086 |
| Weighted residual factors for all reflections included in the refinement |
0.087 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209017.html