Information card for entry 2209061
| Chemical name |
Butyltriphenylphosphonium bis(2-thioxo-1,3-dithiole-4,5-dithiolato)- nickelate(III) |
| Formula |
C28 H24 Ni P S10 |
| Calculated formula |
C28 H24 Ni P S10 |
| SMILES |
[Ni]12(SC3=C(S2)SC(=S)S3)SC2=C(S1)SC(=S)S2.c1(ccccc1)[P+](c1ccccc1)(c1ccccc1)CCCC |
| Title of publication |
Butyltriphenylphosphonium bis(2-thioxo-1,3-dithiole-4,5-dithiolato)nickelate(III) |
| Authors of publication |
Guo, Wen-Feng; Yu, Wen-Tao; Wang, Xin-Qiang; Zhang, Guang-Hui; Xu, Dong |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
6 |
| Pages of publication |
m1419 - m1421 |
| a |
8.373 ± 0.001 Å |
| b |
26.177 ± 0.004 Å |
| c |
16.005 ± 0.002 Å |
| α |
90° |
| β |
111.678 ± 0.002° |
| γ |
90° |
| Cell volume |
3259.9 ± 0.8 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0737 |
| Residual factor for significantly intense reflections |
0.0424 |
| Weighted residual factors for significantly intense reflections |
0.0926 |
| Weighted residual factors for all reflections included in the refinement |
0.1033 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.923 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209061.html