Information card for entry 2209116
| Chemical name |
6-Benzyl-7-hydroxy-1-(2-methoxyphenyl)-1H,7H-2,3- dihydroimidazo[1,2-a]pyrimidin-5-one |
| Formula |
C20 H19 N3 O3 |
| Calculated formula |
C20 H19 N3 O3 |
| SMILES |
Oc1nc2N(CCn2c(=O)c1Cc1ccccc1)c1ccccc1OC |
| Title of publication |
6-Benzyl-7-hydroxy-1-(2-methoxyphenyl)-2,3-dihydro-1<i>H</i>,7<i>H</i>-imidazo[1,2-<i>a</i>]pyrimidin-5-one |
| Authors of publication |
Wysocki, Waldemar; Matosiuk, Dariusz; Karczmarzyk, Zbigniew; Rządkowska, Marzena; Urbańczyk-Lipkowska, Zofia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
6 |
| Pages of publication |
o2548 - o2550 |
| a |
12.1771 ± 0.0006 Å |
| b |
13.2172 ± 0.0007 Å |
| c |
11.0141 ± 0.0008 Å |
| α |
90° |
| β |
90.785 ± 0.005° |
| γ |
90° |
| Cell volume |
1772.52 ± 0.18 Å3 |
| Cell temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0499 |
| Weighted residual factors for all reflections included in the refinement |
0.1565 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209116.html