Information card for entry 2209283
| Chemical name |
3-[5-(3,5-Dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-(4- methoxyphenyl)thiazolidin-4-one |
| Formula |
C20 H19 N3 O2 S2 |
| Calculated formula |
C20 H19 N3 O2 S2 |
| SMILES |
S1C(N(C(=O)C1)c1sc(nn1)c1cc(cc(c1)C)C)c1ccc(OC)cc1 |
| Title of publication |
3-[5-(3,5-Dimethylphenyl)-1,3,4-thiadiazol-2-yl]-2-(4-methoxyphenyl)thiazolidin-4-one |
| Authors of publication |
Wan, Rong; Wu, Feng; Cao, Lin; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
6 |
| Pages of publication |
o2115 - o2116 |
| a |
13.892 ± 0.003 Å |
| b |
7.256 ± 0.0015 Å |
| c |
18.912 ± 0.004 Å |
| α |
90° |
| β |
95.86 ± 0.03° |
| γ |
90° |
| Cell volume |
1896.4 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0623 |
| Residual factor for significantly intense reflections |
0.0451 |
| Weighted residual factors for significantly intense reflections |
0.1312 |
| Weighted residual factors for all reflections included in the refinement |
0.1455 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209283.html