Information card for entry 2209330
| Chemical name |
(1R,5R,6R)-Ethyl 3-benzyl-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| Formula |
C15 H15 N O4 |
| Calculated formula |
C15 H15 N O4 |
| SMILES |
CCOC(=O)[C@@H]1[C@@H]2[C@H]1C(=O)N(C2=O)Cc1ccccc1 |
| Title of publication |
(1<i>R</i>,5<i>R</i>,6<i>R</i>)-Ethyl 3-benzyl-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| Authors of publication |
Wu, Jie-Hua; Zhang, Chun-Tao; Zhou, Li-Na; Wang, Jing-Kang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
6 |
| Pages of publication |
o2331 - o2332 |
| a |
14.185 ± 0.003 Å |
| b |
5.2973 ± 0.0011 Å |
| c |
18.661 ± 0.004 Å |
| α |
90° |
| β |
101.26 ± 0.03° |
| γ |
90° |
| Cell volume |
1375.2 ± 0.5 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.063 |
| Residual factor for significantly intense reflections |
0.046 |
| Weighted residual factors for significantly intense reflections |
0.144 |
| Weighted residual factors for all reflections included in the refinement |
0.157 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.08 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209330.html