Information card for entry 2209384
| Chemical name |
Dichloro[6,6'-bis(chloromethyl)-2,2'-bipyridine]cobalt(II) |
| Formula |
C12 H10 Cl4 Co N2 |
| Calculated formula |
C12 H10 Cl4 Co N2 |
| SMILES |
c12cccc(CCl)[n]2[Co](Cl)(Cl)[n]2c1cccc2CCl |
| Title of publication |
[6,6'-Bis(chloromethyl)-2,2'-bipyridyl]dichlorocobalt(II) |
| Authors of publication |
Nellas, Ricky B.; Fronczek, Frank R.; Newkome, George R.; Watkins, Steven F.; Xia, Yuanjiao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
7 |
| Pages of publication |
m1522 - m1523 |
| a |
7.4783 ± 0.001 Å |
| b |
15.727 ± 0.002 Å |
| c |
12.652 ± 0.002 Å |
| α |
90° |
| β |
104.847 ± 0.006° |
| γ |
90° |
| Cell volume |
1438.3 ± 0.4 Å3 |
| Cell temperature |
105 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.0301 |
| Weighted residual factors for all reflections included in the refinement |
0.0647 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209384.html