Information card for entry 2209416
| Common name |
9-(4-methyoxylbenzoyl)-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-6-one |
| Chemical name |
9-(4-methyoxylbenzoyl)-1,2,3,4,7,8-hexahydropyrido[1,2-a]pyrimidin-6-one |
| Formula |
C16 H18 N2 O3 |
| Calculated formula |
C16 H18 N2 O3 |
| SMILES |
O=C1N2CCCNC2=C(CC1)C(=O)c1ccc(OC)cc1 |
| Title of publication |
9-(4-Methyoxylbenzoyl)-1,2,3,4,7,8-hexahydropyrido[1,2-<i>a</i>]pyrimidin-6-one |
| Authors of publication |
Tao Peng; Sheng-Jiao Yan; Chu-Yi Yu; Zhi-Tang Huang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
7 |
| Pages of publication |
o3040 - o3041 |
| a |
7.5696 ± 0.0017 Å |
| b |
9.725 ± 0.002 Å |
| c |
10.446 ± 0.002 Å |
| α |
88.964 ± 0.004° |
| β |
77.971 ± 0.004° |
| γ |
68.169 ± 0.003° |
| Cell volume |
696.7 ± 0.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0503 |
| Residual factor for significantly intense reflections |
0.0369 |
| Weighted residual factors for significantly intense reflections |
0.0989 |
| Weighted residual factors for all reflections included in the refinement |
0.111 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.013 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209416.html