Information card for entry 2209486
| Common name |
10,10'-Dinitro-10,10'-(butane-1,4-diyl)di-10H-anthracen-9-one |
| Chemical name |
10,10'-Dinitro-10,10'-(butane-1,4-diyl)dianthracen-9(10H)-one |
| Formula |
C32 H24 N2 O6 |
| Calculated formula |
C32 H24 N2 O6 |
| SMILES |
O=C1c2ccccc2C(c2c1cccc2)(CCCCC1(N(=O)=O)c2ccccc2C(c2c1cccc2)=O)N(=O)=O |
| Title of publication |
10,10'-Dinitro-10,10'-(butane-1,4-diyl)dianthracen-9(10<i>H</i>)-one |
| Authors of publication |
Arslan, Mustafa; Asker, Erol; Masnovi, John; Baker, Ronald J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
7 |
| Pages of publication |
o2819 - o2821 |
| a |
11.316 ± 0.001 Å |
| b |
8.33 ± 0.001 Å |
| c |
13.88 ± 0.002 Å |
| α |
90° |
| β |
97.728 ± 0.009° |
| γ |
90° |
| Cell volume |
1296.5 ± 0.3 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.072 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.096 |
| Weighted residual factors for all reflections included in the refinement |
0.11 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209486.html