Information card for entry 2209515
| Chemical name |
3,3,4,4,5,5-Hexafluoro-1,2-bis[5-(3-methoxyphenyl)-3-methyl-2- thienyl]cyclopent-1-ene |
| Formula |
C29 H22 F6 O2 S2 |
| Calculated formula |
C29 H22 F6 O2 S2 |
| SMILES |
COc1cccc(c1)c1sc(c(c1)C)C1=C(c2sc(cc2C)c2cccc(c2)OC)C(C(C1(F)F)(F)F)(F)F |
| Title of publication |
3,3,4,4,5,5-Hexafluoro-1,2-bis[5-(3-methoxyphenyl)-3-methyl-2-thienyl]cyclopent-1-ene |
| Authors of publication |
Yang, Tian-She; Xu, Chun-Yan; Tu, Yuan-Ming; Pu, Shou-Zhi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
7 |
| Pages of publication |
o2617 - o2619 |
| a |
7.8013 ± 0.0011 Å |
| b |
26.675 ± 0.004 Å |
| c |
12.9844 ± 0.0018 Å |
| α |
90° |
| β |
92.654 ± 0.003° |
| γ |
90° |
| Cell volume |
2699.2 ± 0.7 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0858 |
| Residual factor for significantly intense reflections |
0.0546 |
| Weighted residual factors for significantly intense reflections |
0.1408 |
| Weighted residual factors for all reflections included in the refinement |
0.1683 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.022 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209515.html