Information card for entry 2209763
| Chemical name |
Dibromo‒[(<i>E</i>)‒2,4,6‒trimethyl‒<i>N</i>‒(1‒(pyridin‒2‒yl)\ ethylidene)benzenamine-N,N'](acetonitrile)nickel(II) |
| Formula |
C18 H21 Br2 N3 Ni |
| Calculated formula |
C18 H21 Br2 N3 Ni |
| SMILES |
[Ni]1(Br)(Br)([n]2ccccc2C(=[N]1c1c(cc(cc1C)C)C)C)[N]#CC |
| Title of publication |
(Acetonitrile)dibromo{(<i>E</i>)-2,4,6-trimethyl-<i>N</i>-[1-(pyridin-2-yl)ethylidene]aniline-κ^2^<i>N</i>,<i>N</i>'}nickel(II) |
| Authors of publication |
Huang, Bor-Hunn; Su, Sheng-Yuan; Lin, Chu-Chieh |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
8 |
| Pages of publication |
m1830 - m1831 |
| a |
14.4149 ± 0.0017 Å |
| b |
8.8331 ± 0.0011 Å |
| c |
16.0753 ± 0.0019 Å |
| α |
90° |
| β |
92.626 ± 0.003° |
| γ |
90° |
| Cell volume |
2044.7 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0828 |
| Residual factor for significantly intense reflections |
0.0403 |
| Weighted residual factors for significantly intense reflections |
0.0811 |
| Weighted residual factors for all reflections included in the refinement |
0.0883 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209763.html