Information card for entry 2209844
| Common name |
(2S,3a'R,4'R,5'S,6'R)-4',5'-isoprolidenedioxy-6'-(trityloxymethyl) -2'-oxotetrahydro-1H-spiro[pyrrolidine-2,3'-pyrrolo[1,2-b]isoxazole] -1-carbaldehyde |
| Chemical name |
(2S,3a'R,4'R,5'S,6'R)-4',5'-Isoprolidenedioxy-6'-(trityloxymethyl)-2'- oxotetrahydro-1<i>H</i>-spiro[pyrrolidine-2,3'- pyrrolo[1,2-<i>b</i>]isoxazole]-1-carbaldehyde |
| Formula |
C33 H34 N2 O6 |
| Calculated formula |
C33 H34 N2 O6 |
| SMILES |
N1([C@]2(CCC1)C(=O)ON1[C@H]2[C@H]2OC(O[C@H]2[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)(C)C)C=O |
| Title of publication |
(2<i>S</i>,3a'<i>R</i>,4'<i>R</i>,5'<i>S</i>,6'<i>R</i>)-4',5'-Isoprolidenedioxy-6'-(trityloxymethyl)-2'-oxotetrahydro-1<i>H</i>-spiro[pyrrolidine-2,3'-pyrrolo[1,2-<i>b</i>]isoxazole]-1-carbaldehyde |
| Authors of publication |
Chu-Yi Yu; Ying Fu |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
8 |
| Pages of publication |
o3172 - o3173 |
| a |
10.0296 ± 0.0014 Å |
| b |
12.7262 ± 0.0017 Å |
| c |
11.4028 ± 0.0016 Å |
| α |
90° |
| β |
98.942 ± 0.002° |
| γ |
90° |
| Cell volume |
1437.7 ± 0.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0788 |
| Residual factor for significantly intense reflections |
0.0396 |
| Weighted residual factors for significantly intense reflections |
0.0821 |
| Weighted residual factors for all reflections included in the refinement |
0.1018 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.075 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209844.html