Information card for entry 2209914
| Chemical name |
5-[(Cyclohexylamino)methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Formula |
C13 H19 N O4 |
| Calculated formula |
C13 H19 N O4 |
| SMILES |
N(C=C1C(=O)OC(OC1=O)(C)C)C1CCCCC1 |
| Title of publication |
5-[(Cyclohexylamino)methylene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Authors of publication |
Vencato, Ivo; Cunha, Silvio; Ferrari, Jailton; Lariucci, Carlito; Xavier, Leandro C. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
8 |
| Pages of publication |
o3581 - o3583 |
| a |
20.905 ± 0.002 Å |
| b |
10.222 ± 0.001 Å |
| c |
12.516 ± 0.006 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2674.6 ± 1.3 Å3 |
| Cell temperature |
297 ± 2 K |
| Ambient diffraction temperature |
297 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
29 |
| Hermann-Mauguin space group symbol |
P c a 21 |
| Hall space group symbol |
P 2c -2ac |
| Residual factor for all reflections |
0.0682 |
| Residual factor for significantly intense reflections |
0.0574 |
| Weighted residual factors for significantly intense reflections |
0.1467 |
| Weighted residual factors for all reflections included in the refinement |
0.2037 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.196 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2209914.html