Information card for entry 2210007
| Chemical name |
3-Dimethylamino-1,1-dioxo-4,5,6,7-tetrahydro-1H-λ^6^-thia-2,3a,8a-triaza-cyclopenta[a]inden-8-one |
| Formula |
C10 H14 N4 O3 S |
| Calculated formula |
C10 H14 N4 O3 S |
| SMILES |
C1(=O)C2=C(CCCC2)N2C(=NS(=O)(=O)N12)N(C)C |
| Title of publication |
3-Dimethylamino-1,1-dioxo-4,5,6,7-tetrahydro-1<i>H</i>-λ^6^-thia-2,3a,8a-triazacyclopenta[<i>a</i>]inden-8-one, a derivative of a new ring system |
| Authors of publication |
Liepa, Andris J.; Jahangiri, Saba; Fallon, Gary D.; Forsyth, Craig M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
8 |
| Pages of publication |
o3170 - o3171 |
| a |
8.6327 ± 0.0001 Å |
| b |
16.361 ± 0.0003 Å |
| c |
8.4883 ± 0.0001 Å |
| α |
90° |
| β |
98.117 ± 0.001° |
| γ |
90° |
| Cell volume |
1186.87 ± 0.03 Å3 |
| Cell temperature |
123 ± 2 K |
| Ambient diffraction temperature |
123 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.062 |
| Residual factor for significantly intense reflections |
0.039 |
| Weighted residual factors for significantly intense reflections |
0.084 |
| Weighted residual factors for all reflections included in the refinement |
0.091 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210007.html