Information card for entry 2210046
| Chemical name |
(3'R, 4S)-3-(3'-Cyclohexyl-3'-phenylpropionyl)-5,5-dimethyl-4- phenyloxazolidin-2-one |
| Formula |
C26 H31 N O3 |
| Calculated formula |
C26 H31 N O3 |
| SMILES |
O=C(N1C(=O)OC(C)(C)[C@@H]1c1ccccc1)C[C@@H](c1ccccc1)C1CCCCC1 |
| Title of publication |
(3'<i>R</i>,4<i>S</i>)-3-(3'-Cyclohexyl-3'-phenylpropionyl)-5,5-dimethyl-4-phenyloxazolidin-2-one |
| Authors of publication |
Yang, Rui; Nie, Lei; Zhang, Mei-Su; Wang, Juan; Lin, Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o3618 - o3619 |
| a |
10.1004 ± 0.0002 Å |
| b |
14.8636 ± 0.0003 Å |
| c |
15.5876 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2340.14 ± 0.08 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0504 |
| Residual factor for significantly intense reflections |
0.0364 |
| Weighted residual factors for significantly intense reflections |
0.0911 |
| Weighted residual factors for all reflections included in the refinement |
0.1006 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210046.html