Information card for entry 2210228
| Chemical name |
Ethyl 12b-allyl-1-hydroxy-3,6,7,12b-tetrahydro-4H-1,3-dioxolo[4,5-g]pyrido[2,1- a]isoquinoline-2-carboxylate |
| Formula |
C20 H23 N O5 |
| Calculated formula |
C20 H23 N O5 |
| SMILES |
OC1=C(C(=O)OCC)CCN2C1(c1cc3OCOc3cc1CC2)CC=C |
| Title of publication |
Ethyl 12b-allyl-1-hydroxy-3,6,7,12b-tetrahydro-4<i>H</i>-1,3-dioxolo[4,5-<i>g</i>]pyrido[2,1-<i>a</i>]isoquinoline-2-carboxylate |
| Authors of publication |
Ya-Wen Wang; Yu Peng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o3966 - o3967 |
| a |
8.5365 ± 0.0007 Å |
| b |
20.0523 ± 0.0018 Å |
| c |
10.6574 ± 0.0009 Å |
| α |
90° |
| β |
99.854 ± 0.004° |
| γ |
90° |
| Cell volume |
1797.4 ± 0.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1525 |
| Residual factor for significantly intense reflections |
0.0837 |
| Weighted residual factors for significantly intense reflections |
0.1585 |
| Weighted residual factors for all reflections included in the refinement |
0.1799 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.162 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210228.html