Information card for entry 2210238
| Chemical name |
Aquabis(2,4-dichlorophenoxyacetato)(1,10-phenanthroline-κ^2^N,N')copper(II) |
| Formula |
C28 H20 Cl4 Cu N2 O7 |
| Calculated formula |
C28 H20 Cl4 Cu N2 O7 |
| SMILES |
[Cu]1([n]2cccc3ccc4ccc[n]1c4c23)([OH2])(OC(=O)COc1c(Cl)cc(Cl)cc1)OC(=O)COc1c(Cl)cc(Cl)cc1 |
| Title of publication |
Aquabis(2,4-dichlorophenoxyacetato)(1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')copper(II) |
| Authors of publication |
Liu, Ji-Wei; Zhu, Bin; Tian, Ye; Gu, Chang-Sheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
m2030 - m2032 |
| a |
8.6317 ± 0.0017 Å |
| b |
12.595 ± 0.003 Å |
| c |
14.491 ± 0.003 Å |
| α |
111.07 ± 0.03° |
| β |
95.34 ± 0.03° |
| γ |
103.22 ± 0.03° |
| Cell volume |
1404.2 ± 0.7 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0584 |
| Residual factor for significantly intense reflections |
0.0412 |
| Weighted residual factors for significantly intense reflections |
0.1006 |
| Weighted residual factors for all reflections included in the refinement |
0.1116 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210238.html