Information card for entry 2210293
| Chemical name |
Bis[5,6-diphenyl-3-(2-pyridyl)-1,2,4-trizine-κ^2^N,N']manganese(II) monohydrate |
| Formula |
C40 H30 Cl2 Mn N8 O |
| Calculated formula |
C40 H30 Cl2 Mn N8 O |
| SMILES |
[Mn]12(Cl)(Cl)([n]3ccccc3c3nc(c4ccccc4)c(n[n]13)c1ccccc1)[n]1ccccc1c1nc(c3ccccc3)c(n[n]21)c1ccccc1.O |
| Title of publication |
Bis[5,6-diphenyl-3-(2-pyridyl)-1,2,4-triazine-κ^2^<i>N</i>,<i>N</i>']manganese(II) monohydrate |
| Authors of publication |
Eltayeb, Naser Eltaher; Guan, Teoh Siang; Yamin, Bohari M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
m2284 - m2286 |
| a |
24.61 ± 0.005 Å |
| b |
16.166 ± 0.003 Å |
| c |
8.959 ± 0.0017 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3564.3 ± 1.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.036 |
| Weighted residual factors for significantly intense reflections |
0.079 |
| Weighted residual factors for all reflections included in the refinement |
0.083 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.01 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210293.html