Information card for entry 2210357
| Chemical name |
2-(4-Fluorophenyl)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]thiazolidin- 4-one |
| Formula |
C18 H14 F N3 O2 S2 |
| Calculated formula |
C18 H14 F N3 O2 S2 |
| SMILES |
S1C(N(C(=O)C1)c1sc(nn1)c1ccc(OC)cc1)c1ccc(F)cc1 |
| Title of publication |
2-(4-Fluorophenyl)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]thiazolidin-4-one |
| Authors of publication |
Wan, Rong; Wu, Feng; Han, Feng; Guan, Jian-Ling; Zhang, Jin-Jun; Wang, Jin-Tang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o3984 - o3985 |
| a |
17.75 ± 0.004 Å |
| b |
6.372 ± 0.0013 Å |
| c |
31.761 ± 0.006 Å |
| α |
90° |
| β |
101.55 ± 0.03° |
| γ |
90° |
| Cell volume |
3519.5 ± 1.3 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0796 |
| Residual factor for significantly intense reflections |
0.0528 |
| Weighted residual factors for significantly intense reflections |
0.1277 |
| Weighted residual factors for all reflections included in the refinement |
0.1458 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.105 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210357.html