Information card for entry 2210366
| Chemical name |
rel-(1R,4R,9R)-1-Acetyl-9-(1-piperidinyl)-1,4-dihydro-1,4-ethanonaphthalene- 9-carbonitrile |
| Formula |
C20 H22 N2 O |
| Calculated formula |
C20 H22 N2 O |
| SMILES |
N1([C@@]2([C@@H]3c4c(cccc4)[C@](C2)(C=C3)C(=O)C)C#N)CCCCC1 |
| Title of publication |
<i>rel</i>-(1<i>R</i>,4<i>R</i>,9<i>R</i>)-1-Acetyl-9-(1-piperidinyl)-1,4-dihydro-1,4-ethanonaphthalene-9-carbonitrile |
| Authors of publication |
Döpp, Dietrich; Kruse, Claudia; Flörke, Ulrich; Henkel, Gerald |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
9 |
| Pages of publication |
o3904 - o3906 |
| a |
8.869 ± 0.002 Å |
| b |
10.552 ± 0.002 Å |
| c |
17.902 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1675.4 ± 0.6 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.038 |
| Residual factor for significantly intense reflections |
0.0324 |
| Weighted residual factors for significantly intense reflections |
0.0768 |
| Weighted residual factors for all reflections included in the refinement |
0.0802 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210366.html