Information card for entry 2210524
| Chemical name |
Dimethyl 4-{4-[2-(dimethylamino)ethoxy]phenyl}-2,6-dimethyl-1,4-dihydropyridine- 3,5-dicarboxylate |
| Formula |
C21 H28 N2 O5 |
| Calculated formula |
C21 H28 N2 O5 |
| SMILES |
O=C(OC)C1=C(NC(=C(C1c1ccc(OCCN(C)C)cc1)C(=O)OC)C)C |
| Title of publication |
Dimethyl 4-{4-[2-(dimethylamino)ethoxy]phenyl}-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Authors of publication |
Sundar, T. V.; Parthasarathi, V.; Priyanka Jain; Bansal, Ranju; Ravikumar, K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4699 - o4701 |
| a |
8.4072 ± 0.0005 Å |
| b |
11.2593 ± 0.0007 Å |
| c |
11.5788 ± 0.0007 Å |
| α |
71.036 ± 0.001° |
| β |
86.84 ± 0.001° |
| γ |
84.209 ± 0.001° |
| Cell volume |
1030.97 ± 0.11 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0506 |
| Residual factor for significantly intense reflections |
0.045 |
| Weighted residual factors for significantly intense reflections |
0.1311 |
| Weighted residual factors for all reflections included in the refinement |
0.1357 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.058 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210524.html