Information card for entry 2210605
| Chemical name |
3,6-Dimethyl-4,5-dihydro-3a,5a-diazapyrene ditriflate |
| Formula |
C18 H16 F6 N2 O6 S2 |
| Calculated formula |
C18 H16 F6 N2 O6 S2 |
| SMILES |
c12c3c4ccc(C)[n+]3CC[n+]2c(ccc1cc4)C.C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-] |
| Title of publication |
3,6-Dimethyl-4,5-dihydro-3a,5a-diazapyrene ditriflate |
| Authors of publication |
Coe, Benjamin J.; Fitzgerald, Emma C.; Raftery, James |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4333 - o4334 |
| a |
9.976 ± 0.0009 Å |
| b |
12.653 ± 0.0012 Å |
| c |
16.559 ± 0.0015 Å |
| α |
90° |
| β |
97.426 ± 0.002° |
| γ |
90° |
| Cell volume |
2072.7 ± 0.3 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1101 |
| Residual factor for significantly intense reflections |
0.0417 |
| Weighted residual factors for significantly intense reflections |
0.0567 |
| Weighted residual factors for all reflections included in the refinement |
0.0644 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.717 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210605.html