Information card for entry 2210637
| Chemical name |
1-Acetyl-3,3-bis[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-ylmethyl]indolin-2-one |
| Formula |
C30 H25 N5 O6 |
| Calculated formula |
C30 H25 N5 O6 |
| SMILES |
O(C)c1cccc(c1)c1noc(n1)CC1(C(=O)N(C(=O)C)c2ccccc12)Cc1onc(n1)c1cc(OC)ccc1 |
| Title of publication |
1-Acetyl-3,3-bis[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-ylmethyl]indolin-2-one |
| Authors of publication |
Yan, Xiao-Chen; Wang, Hai-Bo; Liu, Zhi-Qian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4640 - o4641 |
| a |
8.63 ± 0.0017 Å |
| b |
11.866 ± 0.002 Å |
| c |
14.616 ± 0.003 Å |
| α |
108.95 ± 0.03° |
| β |
99.02 ± 0.03° |
| γ |
101.17 ± 0.03° |
| Cell volume |
1349.3 ± 0.6 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1551 |
| Residual factor for significantly intense reflections |
0.0896 |
| Weighted residual factors for significantly intense reflections |
0.1859 |
| Weighted residual factors for all reflections included in the refinement |
0.2229 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210637.html