Information card for entry 2210670
| Chemical name |
3,3'-(Pyridine-2,6-diyl)bis(4-allyl-4,5-dihydro-1H-1,2,4-triazole-5-thione) |
| Formula |
C15 H15 N7 S2 |
| Calculated formula |
C15 H15 N7 S2 |
| SMILES |
S=C1NN=C(N1CC=C)c1nc(ccc1)C1=NNC(=S)N1CC=C |
| Title of publication |
3,3'-(Pyridine-2,6-diyl)bis(4-allyl-4,5-dihydro-1<i>H</i>-1,2,4-triazole-5-thione) |
| Authors of publication |
Çetin, Ahmet; Dinçer, Muharrem; Özdemir, Namık; Dayan, Osman; Cansız, Ahmet |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4385 - o4387 |
| a |
10.0527 ± 0.0007 Å |
| b |
10.7295 ± 0.0007 Å |
| c |
16.5864 ± 0.0012 Å |
| α |
73.027 ± 0.005° |
| β |
88.204 ± 0.006° |
| γ |
89.503 ± 0.006° |
| Cell volume |
1710.3 ± 0.2 Å3 |
| Cell temperature |
296 K |
| Ambient diffraction temperature |
296 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0678 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1378 |
| Weighted residual factors for all reflections included in the refinement |
0.1471 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210670.html