Information card for entry 2210700
| Chemical name |
1,2,7,8-Tetramethyl-4,5-dihydro-3a,5a-diazapyrene ditriflate |
| Formula |
C20 H20 F6 N2 O6 S2 |
| Calculated formula |
C20 H20 F6 N2 O6 S2 |
| SMILES |
c12c3c4c(c(c[n+]3CC[n+]2cc(c(c1cc4)C)C)C)C.C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-] |
| Title of publication |
1,2,7,8-Tetramethyl-4,5-dihydro-3a,5a-diazapyrene ditriflate |
| Authors of publication |
Coe, Benjamin J.; Fitzgerald, Emma C.; Raftery, James |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
10 |
| Pages of publication |
o4335 - o4336 |
| a |
12.882 ± 0.0007 Å |
| b |
8.152 ± 0.0004 Å |
| c |
22.585 ± 0.0012 Å |
| α |
90° |
| β |
104.284 ± 0.001° |
| γ |
90° |
| Cell volume |
2298.4 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.057 |
| Residual factor for significantly intense reflections |
0.0471 |
| Weighted residual factors for significantly intense reflections |
0.1256 |
| Weighted residual factors for all reflections included in the refinement |
0.1311 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.078 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210700.html