Information card for entry 2210869
| Chemical name |
Ethyl 6-methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Formula |
C14 H16 N2 O2 S |
| Calculated formula |
C14 H16 N2 O2 S |
| SMILES |
S=C1NC(C(=C(N1)C)C(=O)OCC)c1ccccc1 |
| Title of publication |
Ethyl 6-methyl-4-phenyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Qin, Yong-Qi; Ren, Xiao-Yan; Liang, Tong-Ling; Jian, Fang-Fang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
11 |
| Pages of publication |
o5215 - o5216 |
| a |
7.373 ± 0.0015 Å |
| b |
9.5 ± 0.0019 Å |
| c |
11.059 ± 0.002 Å |
| α |
69.78 ± 0.03° |
| β |
89.91 ± 0.03° |
| γ |
69.89 ± 0.03° |
| Cell volume |
676.5 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1069 |
| Residual factor for significantly intense reflections |
0.0651 |
| Weighted residual factors for significantly intense reflections |
0.1533 |
| Weighted residual factors for all reflections included in the refinement |
0.1807 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.091 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2210869.html