Information card for entry 2211085
| Common name |
2-(2-(1,3-dioxoisoindolin-2-yl)ethyl)isoindoline-1,3-dione |
| Chemical name |
2,2'-(Ethane-1,2-diyl)bis(isoindoline-1,3-dione) |
| Formula |
C18 H12 N2 O4 |
| Calculated formula |
C18 H12 N2 O4 |
| SMILES |
O=C1N(CCN2C(=O)c3c(C2=O)cccc3)C(=O)c2c1cccc2 |
| Title of publication |
2,2'-(Ethane-1,2-diyl)bis(isoindoline-1,3-dione) |
| Authors of publication |
Liang, Zu-Pei; Li, Jian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
11 |
| Pages of publication |
o5282 - o5283 |
| a |
4.8627 ± 0.0012 Å |
| b |
9.312 ± 0.002 Å |
| c |
16.785 ± 0.004 Å |
| α |
90° |
| β |
92.618 ± 0.004° |
| γ |
90° |
| Cell volume |
759.3 ± 0.3 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.077 |
| Residual factor for significantly intense reflections |
0.0433 |
| Weighted residual factors for significantly intense reflections |
0.1009 |
| Weighted residual factors for all reflections included in the refinement |
0.1182 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211085.html