Information card for entry 2211108
| Chemical name |
(2E)-1-(3-Bromo-2-thienyl)-3-(4-methoxy-2,3,6-trimethylphenyl)prop-2-en-1-one |
| Formula |
C17 H17 Br O2 S |
| Calculated formula |
C17 H17 Br O2 S |
| SMILES |
Brc1ccsc1C(=O)/C=C/c1c(c(c(OC)cc1C)C)C |
| Title of publication |
(2<i>E</i>)-1-(3-Bromo-2-thienyl)-3-(4-methoxy-2,3,6-trimethylphenyl)prop-2-en-1-one |
| Authors of publication |
Yathirajan, H. S.; Narayana, B.; Ashalatha, B.; Sarojini, B. K.; Bolte, Michael |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
11 |
| Pages of publication |
o5010 - o5012 |
| a |
8.1973 ± 0.0007 Å |
| b |
12.3023 ± 0.0011 Å |
| c |
16.0999 ± 0.0013 Å |
| α |
90° |
| β |
103.953 ± 0.006° |
| γ |
90° |
| Cell volume |
1575.7 ± 0.2 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0666 |
| Residual factor for significantly intense reflections |
0.0543 |
| Weighted residual factors for significantly intense reflections |
0.1329 |
| Weighted residual factors for all reflections included in the refinement |
0.1411 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211108.html