Information card for entry 2211399
| Common name |
2,5-diamino-thiophene-3,4-dicarboxylic acid diethyl ester |
| Chemical name |
diethyl 2,5-diaminothiophene-3,4-dicarboxylate |
| Formula |
C10 H14 N2 O4 S |
| Calculated formula |
C10 H14 N2 O4 S |
| SMILES |
s1c(N)c(c(c1N)C(=O)OCC)C(=O)OCC |
| Title of publication |
Hydrogen-bonded network of diethyl 2,5-diaminothiophene-3,4-dicarboxylate |
| Authors of publication |
Bourgeaux, Marie; Vomsheid, Sophie; Skene, W. G. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
12 |
| Pages of publication |
o5529 - o5531 |
| a |
9.5306 ± 0.0003 Å |
| b |
8.8206 ± 0.0003 Å |
| c |
15.5518 ± 0.0005 Å |
| α |
90° |
| β |
105.963 ± 0.001° |
| γ |
90° |
| Cell volume |
1256.96 ± 0.07 Å3 |
| Cell temperature |
220 ± 2 K |
| Ambient diffraction temperature |
220 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0447 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for significantly intense reflections |
0.1225 |
| Weighted residual factors for all reflections included in the refinement |
0.1255 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.071 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211399.html