Information card for entry 2211512
| Chemical name |
(R,S)-2,2'-(Ethane-1,2-diyldiiminio)dibutan-1-ol dinitrate |
| Formula |
C10 H26 N4 O8 |
| Calculated formula |
C10 H26 N4 O8 |
| SMILES |
C(C)[C@H](CO)[NH2+]CC[NH2+][C@@H](CC)CO.N(=O)(=O)[O-].N(=O)(=O)[O-] |
| Title of publication |
(<i>R</i>,<i>S</i>)-2,2'-(Ethane-1,2-diyldiiminio)dibutan-1-ol dinitrate |
| Authors of publication |
Bai, Guo-Yi; Zhang, Chen-Fang; Simpson, Jim; Ning, Hui-Sen; Peng, Hong-Wei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
12 |
| Pages of publication |
o5580 - o5581 |
| a |
23.35 ± 0.005 Å |
| b |
5.5367 ± 0.0011 Å |
| c |
13.167 ± 0.003 Å |
| α |
90° |
| β |
99.03 ± 0.03° |
| γ |
90° |
| Cell volume |
1681.2 ± 0.6 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0992 |
| Residual factor for significantly intense reflections |
0.0595 |
| Weighted residual factors for significantly intense reflections |
0.1387 |
| Weighted residual factors for all reflections included in the refinement |
0.1577 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.122 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211512.html