Information card for entry 2211591
| Chemical name |
(1S*,2S*,5S*,9S*,10S*,11R*,18R*)-9,10,18-trihydroxy-12,12-dimethyl-6-methylene- 17-oxapentacyclo[7.6.2.1^5,8^.0^1,11^.0^2,8^]octadecane-7,15-dione |
| Formula |
C20 H26 O6 |
| Calculated formula |
C20 H26 O6 |
| SMILES |
O=C1[C@@]23[C@@H]4CC[C@H]5C(=C)C(=O)[C@]4([C@](O)(OC3)[C@@H](O)[C@@H]2C(CC1)(C)C)[C@@H]5O |
| Title of publication |
(1<i>S</i>*,2<i>S</i>*,5<i>S</i>*,9<i>S</i>*,10<i>S</i>*,11<i>R</i>*,18<i>R</i>*)-9,10,18-Trihydroxy-12,12-dimethyl-6-methylene-17-oxapentacyclo[7.6.2.1^5,8^.0^1,11^.0^2,8^]octadecane-7,15-dione |
| Authors of publication |
Shi, Hao; Huang, Ming-Liang; Lü, Ya-Ping |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2006 |
| Journal volume |
62 |
| Journal issue |
12 |
| Pages of publication |
o5472 - o5474 |
| a |
10.826 ± 0.0011 Å |
| b |
6.5434 ± 0.0007 Å |
| c |
13.004 ± 0.0013 Å |
| α |
90° |
| β |
111.774 ± 0.002° |
| γ |
90° |
| Cell volume |
855.47 ± 0.15 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0409 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.095 |
| Weighted residual factors for all reflections included in the refinement |
0.0964 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211591.html