Information card for entry 2211707
| Chemical name |
3-Ethyl-5-(4-oxochroman-3-ylmethylene)-1,3-imidazolidine-2,4-dione |
| Formula |
C15 H12 N2 O4 |
| Calculated formula |
C15 H12 N2 O4 |
| SMILES |
O=C1N(C(=O)NC/1=C\c1c(=O)c2c(oc1)cccc2)CC |
| Title of publication |
3-Ethyl-5-(4-oxochroman-3-ylmethylene)-1,3-imidazolidine-2,4-dione |
| Authors of publication |
Aslantaş, Mehmet; Ceylan–Ünlüsoy, Meltem; Ertan, Rahmiye; Kendi, Engin; Büyükgüngör, Orhan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
o184 - o185 |
| a |
5.3407 ± 0.0004 Å |
| b |
10.407 ± 0.0008 Å |
| c |
12.0223 ± 0.0009 Å |
| α |
106.953 ± 0.006° |
| β |
101.066 ± 0.006° |
| γ |
92.143 ± 0.006° |
| Cell volume |
624.18 ± 0.09 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.0428 |
| Weighted residual factors for all reflections included in the refinement |
0.1144 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211707.html
