Information card for entry 2211715
| Chemical name |
2,3-Bis(hydroxymethyl)-6-(isopropyl)perhydro-2,3,4a,6,7a- pentaazacyclopenta[cd]indene-1,4-dione |
| Formula |
C11 H19 N5 O4 |
| Calculated formula |
C11 H19 N5 O4 |
| SMILES |
CC(C)N1CN2C(=O)N(C3C2N(C1)C(=O)N3CO)CO |
| Title of publication |
2,3-Bis(hydroxymethyl)-6-isopropylperhydro-2,3,4a,6,7a-pentaazacyclopenta[<i>cd</i>]indene-1,4-dione |
| Authors of publication |
Hai-Ling Xi; Meng Gao; Li-Ping Cao; Yi-Tao Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
o400 - o401 |
| a |
12.778 ± 0.003 Å |
| b |
12.655 ± 0.003 Å |
| c |
15.926 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2575.3 ± 1.1 Å3 |
| Cell temperature |
292 ± 2 K |
| Ambient diffraction temperature |
292 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
61 |
| Hermann-Mauguin space group symbol |
P b c a |
| Hall space group symbol |
-P 2ac 2ab |
| Residual factor for all reflections |
0.1318 |
| Residual factor for significantly intense reflections |
0.0575 |
| Weighted residual factors for significantly intense reflections |
0.1111 |
| Weighted residual factors for all reflections included in the refinement |
0.1269 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.827 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211715.html