Information card for entry 2211844
| Chemical name |
N,N'-Bis[(3,4-methylenedioxyphenyl)methylene]phenylene-1,4-diamine |
| Formula |
C22 H20 N2 O4 |
| Calculated formula |
C22 H20 N2 O4 |
| SMILES |
C1Oc2c(O1)cc(cc2)CNc1ccc(cc1)NCc1ccc2c(c1)OCO2 |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis[(3,4-methylenedioxyphenyl)methylene]phenylene-1,4-diamine |
| Authors of publication |
Yang, Shu-Ping; Li-Jun, Han; Da-Qi, Wang; Tie-Zhu, Ding |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
o244 - o246 |
| a |
14.2255 ± 0.0014 Å |
| b |
4.9257 ± 0.0016 Å |
| c |
12.7837 ± 0.0018 Å |
| α |
90° |
| β |
101.624 ± 0.003° |
| γ |
90° |
| Cell volume |
877.4 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0743 |
| Residual factor for significantly intense reflections |
0.0468 |
| Weighted residual factors for significantly intense reflections |
0.1143 |
| Weighted residual factors for all reflections included in the refinement |
0.1356 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.016 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211844.html