Information card for entry 2211868
| Chemical name |
(4R)-5,5-Dimethyl-4-phenyl-3-[(E)-3-phenylacryloyl]-1,3-oxazolidin-2-one |
| Formula |
C20 H19 N O3 |
| Calculated formula |
C20 H19 N O3 |
| SMILES |
[C@H]1(C(C)(C)OC(=O)N1C(=O)/C=C/c1ccccc1)c1ccccc1 |
| Title of publication |
(4<i>R</i>)-5,5-Dimethyl-4-phenyl-3-[(<i>E</i>)-3-phenylacryloyl]-1,3-oxazolidin-2-one |
| Authors of publication |
Yang, Rui; Zhang, Mei-Su; Nie, Lei; Chen, Jing; Lin, Jun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
o182 - o183 |
| a |
5.7455 ± 0.0007 Å |
| b |
12.8894 ± 0.0016 Å |
| c |
11.6696 ± 0.0014 Å |
| α |
90° |
| β |
94.317 ± 0.002° |
| γ |
90° |
| Cell volume |
861.75 ± 0.18 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0508 |
| Residual factor for significantly intense reflections |
0.034 |
| Weighted residual factors for significantly intense reflections |
0.0752 |
| Weighted residual factors for all reflections included in the refinement |
0.0838 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211868.html