Information card for entry 2211890
| Common name |
(6S)-Methyl-L-swainsonine |
| Chemical name |
(1R,2S,6S,8S,8aS)-6-methyloctahydroindolizine-1,2,8-triol |
| Formula |
C9 H17 N O3 |
| Calculated formula |
C9 H17 N O3 |
| SMILES |
[C@@H]12N(C[C@@H]([C@@H]1O)O)C[C@H](C[C@@H]2O)C |
| Title of publication |
(6<i>S</i>)-Methyl-<small>L</small>-swainsonine [(1<i>R</i>,2<i>S</i>,6<i>S</i>,8<i>S</i>,8a<i>S</i>)-6-methyloctahydroindolizine-1,2,8-triol] |
| Authors of publication |
Håkansson, Anders E.; Horne, Graeme; Fleet, George W.J.; Watkin, David J. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
o210 - o212 |
| a |
11.4494 ± 0.0006 Å |
| b |
11.4494 ± 0.0006 Å |
| c |
6.1727 ± 0.0002 Å |
| α |
90° |
| β |
90° |
| γ |
120° |
| Cell volume |
700.76 ± 0.06 Å3 |
| Cell temperature |
190 K |
| Ambient diffraction temperature |
190 K |
| Number of distinct elements |
4 |
| Space group number |
144 |
| Hermann-Mauguin space group symbol |
P 31 |
| Hall space group symbol |
P 31 |
| Residual factor for all reflections |
0.0298 |
| Residual factor for significantly intense reflections |
0.0282 |
| Weighted residual factors for all reflections |
0.069 |
| Weighted residual factors for significantly intense reflections |
0.0681 |
| Weighted residual factors for all reflections included in the refinement |
0.069 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.972 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211890.html