Information card for entry 2211954
| Chemical name |
(S,S)-2,2'-(1,2-Ethanediyldiimino)bis-1-butanol |
| Formula |
C10 H24 N2 O2 |
| Calculated formula |
C10 H24 N2 O2 |
| SMILES |
OC[C@@H](NCCN[C@H](CO)CC)CC |
| Title of publication |
(<i>S</i>,<i>S</i>)-2,2'-(1,2-Ethanediyldiimino)dibutan-1-ol. Corrigendum |
| Authors of publication |
Bai, Guo-Yi; Zhang, Chen-Fang; Zhang, Yue-Cheng; Zeng, Tao; Li, Jiang-Sheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
e2 - e3 |
| a |
7.157 ± 0.003 Å |
| b |
8.44 ± 0.004 Å |
| c |
10.193 ± 0.005 Å |
| α |
90° |
| β |
95.631 ± 0.008° |
| γ |
90° |
| Cell volume |
612.7 ± 0.5 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0606 |
| Residual factor for significantly intense reflections |
0.0406 |
| Weighted residual factors for significantly intense reflections |
0.0917 |
| Weighted residual factors for all reflections included in the refinement |
0.1027 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.066 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211954.html