Information card for entry 2211969
| Chemical name |
3-Formylphenyl-2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside |
| Formula |
C21 H24 O11 |
| Calculated formula |
C21 H24 O11 |
| SMILES |
O([C@@H]1O[C@@H]([C@@H](OC(=O)C)[C@H](OC(=O)C)[C@H]1OC(=O)C)COC(=O)C)c1cccc(c1)C=O |
| Title of publication |
3-Formylphenyl-2,3,4,6-tetra-<i>O</i>-acetyl-β-<small>D</small>-glucopyranoside |
| Authors of publication |
Burkhardt, Anja; Buchholz, Axel; Görls, Helmar; Plass, Winfried |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
1 |
| Pages of publication |
o387 - o388 |
| a |
11.126 ± 0.002 Å |
| b |
8.0199 ± 0.0016 Å |
| c |
12.414 ± 0.003 Å |
| α |
90° |
| β |
101.15 ± 0.03° |
| γ |
90° |
| Cell volume |
1086.8 ± 0.4 Å3 |
| Cell temperature |
183 ± 2 K |
| Ambient diffraction temperature |
183 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0581 |
| Residual factor for significantly intense reflections |
0.038 |
| Weighted residual factors for significantly intense reflections |
0.0808 |
| Weighted residual factors for all reflections included in the refinement |
0.0893 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2211969.html