Information card for entry 2212039
| Common name |
Bis(creatininium) 2,5-dicarboxybenzene-1,4-dicarboxylate |
| Chemical name |
Bis(creatininium) 2,5-dicarboxybenzene-1,4-dicarboxylate |
| Formula |
C18 H20 N6 O10 |
| Calculated formula |
C18 H20 N6 O10 |
| SMILES |
C(=O)(c1c(C(=O)O)cc(C(=O)[O-])c(C(=O)O)c1)[O-].O=C1CN(C)C(=[NH2+])N1.CN1C(=[NH2+])NC(=O)C1 |
| Title of publication |
Bis(creatininium) 2,5-dicarboxybenzene-1,4-dicarboxylate |
| Authors of publication |
Tabatabaee, Masoumeh; Ghassemzadeh, Mitra; Jafari, Padideh; Khavasi, Hamid Reza |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
o1001 - o1002 |
| a |
7.4863 ± 0.0016 Å |
| b |
12.825 ± 0.002 Å |
| c |
10.846 ± 0.002 Å |
| α |
90° |
| β |
97.418 ± 0.016° |
| γ |
90° |
| Cell volume |
1032.6 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0524 |
| Residual factor for significantly intense reflections |
0.0449 |
| Weighted residual factors for significantly intense reflections |
0.1087 |
| Weighted residual factors for all reflections included in the refinement |
0.1129 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.114 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212039.html