Information card for entry 2212120
| Chemical name |
(1H-Imidazole-κN^3^)[N-(2-oxidobenzyl)-L-leucinato-κ^3^O,N,O']copper(II) |
| Formula |
C16 H21 Cu N3 O3 |
| Calculated formula |
C16 H21 Cu N3 O3 |
| SMILES |
[Cu@@]12([NH](Cc3c(cccc3)O1)[C@H](C(=O)O2)CC(C)C)[n]1c[nH]cc1 |
| Title of publication |
(1<i>H</i>-Imidazole-κ<i>N</i>^3^)[<i>N</i>-(2-oxidobenzyl)-<small>L</small>-leucinato-κ^3^<i>O</i>,<i>N</i>,<i>O</i>']copper(II) |
| Authors of publication |
Zhao, Gan-Qing; Xie, Ji-Min; Shao, Min; Sun, Lu; Song, Yuan-Zhi |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2007 |
| Journal volume |
63 |
| Journal issue |
2 |
| Pages of publication |
m532 - m534 |
| a |
7.1094 ± 0.0009 Å |
| b |
12.0945 ± 0.0015 Å |
| c |
19.731 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1696.6 ± 0.4 Å3 |
| Cell temperature |
273 ± 2 K |
| Ambient diffraction temperature |
273 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0547 |
| Residual factor for significantly intense reflections |
0.0436 |
| Weighted residual factors for significantly intense reflections |
0.1029 |
| Weighted residual factors for all reflections included in the refinement |
0.1107 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.081 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2212120.html